C21H40O2Si2 — CID 12027344
6-[tert-butyl(dimethyl)silyl]oxy-1-tri(propan-2-yl)silylhexa-1,4-diyn-3-ol (PubChem CID 12027344) has the molecular formula C21H40O2Si2 and a molecular weight of 380.72 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-1-tri(propan-2-yl)silylhexa-1,4-diyn-3-ol.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-1-tri(propan-2-yl)silylhexa-1,4-diyn-3-ol |
|---|---|
| PubChem CID | 12027344 |
| Molecular Formula | C21H40O2Si2 |
| Molecular Weight | 380.72 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-1-tri(propan-2-yl)silylhexa-1,4-diyn-3-ol |
| SMILES | CC(C)[Si](C#CC(O)C#CCO[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H40O2Si2/c1-17(2)25(18(3)4,19(5)6)16-14-20(22)13-12-15-23-24(10,11)21(7,8)9/h17-20,22H,15H2,1-11H3 |
| InChIKey | DNIJLXFOOSQHBZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.72 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|