C18H44O3Si3 — CID 91758702
[(2S,3S,4R)-2,4-bis[[ethyl(dimethyl)silyl]oxy]hexan-3-yl]oxy-ethyl-dimethylsilane (PubChem CID 91758702) has the molecular formula C18H44O3Si3 and a molecular weight of 392.81 g/mol. Its IUPAC name is [(2S,3S,4R)-2,4-bis[[ethyl(dimethyl)silyl]oxy]hexan-3-yl]oxy-ethyl-dimethylsilane.
| Compound Name | [(2S,3S,4R)-2,4-bis[[ethyl(dimethyl)silyl]oxy]hexan-3-yl]oxy-ethyl-dimethylsilane |
|---|---|
| PubChem CID | 91758702 |
| Molecular Formula | C18H44O3Si3 |
| Molecular Weight | 392.81 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | [(2S,3S,4R)-2,4-bis[[ethyl(dimethyl)silyl]oxy]hexan-3-yl]oxy-ethyl-dimethylsilane |
| SMILES | CC[C@@H](O[Si](C)(C)CC)[C@@H](O[Si](C)(C)CC)[C@H](C)O[Si](C)(C)CC |
| InChI | InChI=1S/C18H44O3Si3/c1-12-17(20-23(8,9)14-3)18(21-24(10,11)15-4)16(5)19-22(6,7)13-2/h16-18H,12-15H2,1-11H3/t16-,17+,18-/m0/s1 |
| InChIKey | KUSMDKOOBOPPSF-KSZLIROESA-N |
| XLogP | 6.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.81 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|