C20H40O5Si — CID 23243307
1-[(2R,3S)-3-[(2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxan-3-yl]oxyoxan-2-yl]ethanol (PubChem CID 23243307) has the molecular formula C20H40O5Si and a molecular weight of 388.62 g/mol. Its IUPAC name is 1-[(2R,3S)-3-[(2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxan-3-yl]oxyoxan-2-yl]ethanol.
| Compound Name | 1-[(2R,3S)-3-[(2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxan-3-yl]oxyoxan-2-yl]ethanol |
|---|---|
| PubChem CID | 23243307 |
| Molecular Formula | C20H40O5Si |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 1-[(2R,3S)-3-[(2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxan-3-yl]oxyoxan-2-yl]ethanol |
| SMILES | CC(O)[C@H]1OCCC[C@@H]1O[C@@H]1CCCO[C@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O5Si/c1-15(21)19-18(10-8-13-23-19)25-17-9-7-12-22-16(17)11-14-24-26(5,6)20(2,3)4/h15-19,21H,7-14H2,1-6H3/t15?,16-,17+,18-,19+/m0/s1 |
| InChIKey | ZSUOMLUONMONAJ-HDDXRBDOSA-N |
| XLogP | 3.89 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|