C16H32O4Si — CID 56593726
2-[(4aR,6R,8aS)-2,2-ditert-butyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]ethanol (PubChem CID 56593726) has the molecular formula C16H32O4Si and a molecular weight of 316.51 g/mol. Its IUPAC name is 2-[(4aR,6R,8aS)-2,2-ditert-butyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]ethanol.
| Compound Name | 2-[(4aR,6R,8aS)-2,2-ditert-butyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]ethanol |
|---|---|
| PubChem CID | 56593726 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | 2-[(4aR,6R,8aS)-2,2-ditert-butyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]ethanol |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2O[C@@H](CCO)CC[C@@H]2O1 |
| InChI | InChI=1S/C16H32O4Si/c1-15(2,3)21(16(4,5)6)18-11-14-13(20-21)8-7-12(19-14)9-10-17/h12-14,17H,7-11H2,1-6H3/t12-,13+,14-/m1/s1 |
| InChIKey | HBIRUQCTLWNPOC-HZSPNIEDSA-N |
| XLogP | 3.37 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|