C22H40O4Si2 — CID 134885279
(2R,3R,4R,5S,6R)-3-ethynyl-2-(hydroxymethyl)-6-(2-trimethylsilylethynyl)-5-tri(propan-2-yl)silyloxyoxan-4-ol (PubChem CID 134885279) has the molecular formula C22H40O4Si2 and a molecular weight of 424.73 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-3-ethynyl-2-(hydroxymethyl)-6-(2-trimethylsilylethynyl)-5-tri(propan-2-yl)silyloxyoxan-4-ol.
| Compound Name | (2R,3R,4R,5S,6R)-3-ethynyl-2-(hydroxymethyl)-6-(2-trimethylsilylethynyl)-5-tri(propan-2-yl)silyloxyoxan-4-ol |
|---|---|
| PubChem CID | 134885279 |
| Molecular Formula | C22H40O4Si2 |
| Molecular Weight | 424.73 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | (2R,3R,4R,5S,6R)-3-ethynyl-2-(hydroxymethyl)-6-(2-trimethylsilylethynyl)-5-tri(propan-2-yl)silyloxyoxan-4-ol |
| SMILES | C#C[C@@H]1[C@@H](O)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C#C[Si](C)(C)C)O[C@H]1CO |
| InChI | InChI=1S/C22H40O4Si2/c1-11-18-20(14-23)25-19(12-13-27(8,9)10)22(21(18)24)26-28(15(2)3,16(4)5)17(6)7/h1,15-24H,14H2,2-10H3/t18-,19+,20-,21+,22+/m0/s1 |
| InChIKey | FYPOPHGVGBSYFY-MLBCHFTJSA-N |
| XLogP | 3.80 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.73 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|