C19H42O4Si2 — CID 11811227
[(2R,3R)-3-[(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]oxiran-2-yl]methanol (PubChem CID 11811227) has the molecular formula C19H42O4Si2 and a molecular weight of 390.71 g/mol. Its IUPAC name is [(2R,3R)-3-[(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]oxiran-2-yl]methanol.
| Compound Name | [(2R,3R)-3-[(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 11811227 |
| Molecular Formula | C19H42O4Si2 |
| Molecular Weight | 390.71 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | [(2R,3R)-3-[(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]oxiran-2-yl]methanol |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C[C@H]1O[C@@H]1CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H42O4Si2/c1-14(22-24(8,9)18(2,3)4)15(12-16-17(13-20)21-16)23-25(10,11)19(5,6)7/h14-17,20H,12-13H2,1-11H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | SZLXDQOQJNZKBW-QBPKDAKJSA-N |
| XLogP | 4.94 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.71 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|