C21H46O4Si2 — CID 11811835
[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-tri(propan-2-yl)silyloxyethyl]-2-methyloxiran-2-yl]methanol (PubChem CID 11811835) has the molecular formula C21H46O4Si2 and a molecular weight of 418.77 g/mol. Its IUPAC name is [(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-tri(propan-2-yl)silyloxyethyl]-2-methyloxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-tri(propan-2-yl)silyloxyethyl]-2-methyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 11811835 |
| Molecular Formula | C21H46O4Si2 |
| Molecular Weight | 418.77 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | [(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-tri(propan-2-yl)silyloxyethyl]-2-methyloxiran-2-yl]methanol |
| SMILES | CC(C)[Si](OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@]1(C)CO)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H46O4Si2/c1-15(2)27(16(3)4,17(5)6)23-13-18(19-21(10,14-22)24-19)25-26(11,12)20(7,8)9/h15-19,22H,13-14H2,1-12H3/t18-,19+,21+/m1/s1 |
| InChIKey | DYRFMXMYOQYJIN-DYXWJJEUSA-N |
| XLogP | 5.72 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.77 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|