C13H28O5Si — CID 134855207
(1R,2S)-1-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]propane-1,2,3-triol (PubChem CID 134855207) has the molecular formula C13H28O5Si and a molecular weight of 292.45 g/mol. Its IUPAC name is (1R,2S)-1-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]propane-1,2,3-triol.
| Compound Name | (1R,2S)-1-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 134855207 |
| Molecular Formula | C13H28O5Si |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (1R,2S)-1-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]propane-1,2,3-triol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]1(C)O[C@H]1[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C13H28O5Si/c1-12(2,3)19(5,6)17-8-13(4)11(18-13)10(16)9(15)7-14/h9-11,14-16H,7-8H2,1-6H3/t9-,10+,11-,13-/m0/s1 |
| InChIKey | HCCJEXDWMLRKAF-NOHGZBONSA-N |
| XLogP | 0.88 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|