C18H38O3Si — CID 11688526
[(2R,3R)-3-[(2R)-2-methyl-2-tri(propan-2-yl)silyloxypentyl]oxiran-2-yl]methanol (PubChem CID 11688526) has the molecular formula C18H38O3Si and a molecular weight of 330.59 g/mol. Its IUPAC name is [(2R,3R)-3-[(2R)-2-methyl-2-tri(propan-2-yl)silyloxypentyl]oxiran-2-yl]methanol.
| Compound Name | [(2R,3R)-3-[(2R)-2-methyl-2-tri(propan-2-yl)silyloxypentyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 11688526 |
| Molecular Formula | C18H38O3Si |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | [(2R,3R)-3-[(2R)-2-methyl-2-tri(propan-2-yl)silyloxypentyl]oxiran-2-yl]methanol |
| SMILES | CCC[C@](C)(C[C@H]1O[C@@H]1CO)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H38O3Si/c1-9-10-18(8,11-16-17(12-19)20-16)21-22(13(2)3,14(4)5)15(6)7/h13-17,19H,9-12H2,1-8H3/t16-,17-,18-/m1/s1 |
| InChIKey | JPBLKOUSTGBHND-KZNAEPCWSA-N |
| XLogP | 4.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|