C14H30O3Si — CID 46933875
[(2S,3S)-3-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylbutyl]oxiran-2-yl]methanol (PubChem CID 46933875) has the molecular formula C14H30O3Si and a molecular weight of 274.48 g/mol. Its IUPAC name is [(2S,3S)-3-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylbutyl]oxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylbutyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 46933875 |
| Molecular Formula | C14H30O3Si |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | [(2S,3S)-3-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylbutyl]oxiran-2-yl]methanol |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@@H]1O[C@H]1CO |
| InChI | InChI=1S/C14H30O3Si/c1-10(8-12-13(9-15)16-12)11(2)17-18(6,7)14(3,4)5/h10-13,15H,8-9H2,1-7H3/t10-,11-,12-,13-/m0/s1 |
| InChIKey | QZTQXHAAGPVXGA-CYDGBPFRSA-N |
| XLogP | 3.18 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|