C16H34O3Si — CID 14967405
3-(3-methyloxiran-2-yl)-1-tri(propan-2-yl)silyloxybutan-2-ol (PubChem CID 14967405) has the molecular formula C16H34O3Si and a molecular weight of 302.53 g/mol. Its IUPAC name is 3-(3-methyloxiran-2-yl)-1-tri(propan-2-yl)silyloxybutan-2-ol.
| Compound Name | 3-(3-methyloxiran-2-yl)-1-tri(propan-2-yl)silyloxybutan-2-ol |
|---|---|
| PubChem CID | 14967405 |
| Molecular Formula | C16H34O3Si |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | 3-(3-methyloxiran-2-yl)-1-tri(propan-2-yl)silyloxybutan-2-ol |
| SMILES | CC1OC1C(C)C(O)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H34O3Si/c1-10(2)20(11(3)4,12(5)6)18-9-15(17)13(7)16-14(8)19-16/h10-17H,9H2,1-8H3 |
| InChIKey | NDLHZVIMZQCGCM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|