C28H60O5Si2 — CID 11731167
(2R,3S,7R,8S)-5-methyl-2,8-bis[tri(propan-2-yl)silyloxymethyl]oxocane-3,7-diol (PubChem CID 11731167) has the molecular formula C28H60O5Si2 and a molecular weight of 532.96 g/mol. Its IUPAC name is (2R,3S,7R,8S)-5-methyl-2,8-bis[tri(propan-2-yl)silyloxymethyl]oxocane-3,7-diol.
| Compound Name | (2R,3S,7R,8S)-5-methyl-2,8-bis[tri(propan-2-yl)silyloxymethyl]oxocane-3,7-diol |
|---|---|
| PubChem CID | 11731167 |
| Molecular Formula | C28H60O5Si2 |
| Molecular Weight | 532.96 g/mol |
| Exact Mass | 532.40 |
| IUPAC Name | (2R,3S,7R,8S)-5-methyl-2,8-bis[tri(propan-2-yl)silyloxymethyl]oxocane-3,7-diol |
| SMILES | CC1C[C@@H](O)[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)O[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O)C1 |
| InChI | InChI=1S/C28H60O5Si2/c1-18(2)34(19(3)4,20(5)6)31-16-27-25(29)14-24(13)15-26(30)28(33-27)17-32-35(21(7)8,22(9)10)23(11)12/h18-30H,14-17H2,1-13H3/t24?,25-,26+,27+,28- |
| InChIKey | QWRQCKOOLFILRB-DFSHVDGTSA-N |
| XLogP | 7.28 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.96 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|