C24H52O4Si2 — CID 11224982
[(2S,3S)-3-[(1R)-1,2-bis[tri(propan-2-yl)silyloxy]ethyl]-2-methyloxiran-2-yl]methanol (PubChem CID 11224982) has the molecular formula C24H52O4Si2 and a molecular weight of 460.85 g/mol. Its IUPAC name is [(2S,3S)-3-[(1R)-1,2-bis[tri(propan-2-yl)silyloxy]ethyl]-2-methyloxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-[(1R)-1,2-bis[tri(propan-2-yl)silyloxy]ethyl]-2-methyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 11224982 |
| Molecular Formula | C24H52O4Si2 |
| Molecular Weight | 460.85 g/mol |
| Exact Mass | 460.34 |
| IUPAC Name | [(2S,3S)-3-[(1R)-1,2-bis[tri(propan-2-yl)silyloxy]ethyl]-2-methyloxiran-2-yl]methanol |
| SMILES | CC(C)[Si](OC[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1O[C@@]1(C)CO)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H52O4Si2/c1-16(2)29(17(3)4,18(5)6)26-14-22(23-24(13,15-25)27-23)28-30(19(7)8,20(9)10)21(11)12/h16-23,25H,14-15H2,1-13H3/t22-,23+,24+/m1/s1 |
| InChIKey | XWFVEKLMZSOCGO-SGNDLWITSA-N |
| XLogP | 6.89 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.85 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|