C20H42O3Si2 — CID 134848527
(2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylhex-5-yn-1-ol (PubChem CID 134848527) has the molecular formula C20H42O3Si2 and a molecular weight of 386.73 g/mol. Its IUPAC name is (2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylhex-5-yn-1-ol.
| Compound Name | (2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylhex-5-yn-1-ol |
|---|---|
| PubChem CID | 134848527 |
| Molecular Formula | C20H42O3Si2 |
| Molecular Weight | 386.73 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | (2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylhex-5-yn-1-ol |
| SMILES | C#C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](CO)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O3Si2/c1-13-18(23-25(11,12)20(6,7)8)16(2)17(14-21)15-22-24(9,10)19(3,4)5/h1,16-18,21H,14-15H2,2-12H3/t16-,17-,18+/m0/s1 |
| InChIKey | QZYNZGPGHVMGHB-OKZBNKHCSA-N |
| XLogP | 5.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.73 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|