C20H34O2Si — CID 134884608
7-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxycyclododeca-2,8-diyn-1-ol (PubChem CID 134884608) has the molecular formula C20H34O2Si and a molecular weight of 334.58 g/mol. Its IUPAC name is 7-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxycyclododeca-2,8-diyn-1-ol.
| Compound Name | 7-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxycyclododeca-2,8-diyn-1-ol |
|---|---|
| PubChem CID | 134884608 |
| Molecular Formula | C20H34O2Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 7-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxycyclododeca-2,8-diyn-1-ol |
| SMILES | CC(C)C(C)(C)[Si](C)(C)OC1C#CCCCC(O)C#CCCC1 |
| InChI | InChI=1S/C20H34O2Si/c1-17(2)20(3,4)23(5,6)22-19-15-11-7-9-13-18(21)14-10-8-12-16-19/h17-19,21H,7-9,12-13,16H2,1-6H3 |
| InChIKey | XDXCBUBXHUIOOC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|