C23H46O5Si — CID 101369906
(2R,3S,4S,5S)-2-(2-methoxyethoxymethoxy)-3,5-dimethyl-1-tri(propan-2-yl)silyloxyoct-6-yn-4-ol (PubChem CID 101369906) has the molecular formula C23H46O5Si and a molecular weight of 430.70 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-(2-methoxyethoxymethoxy)-3,5-dimethyl-1-tri(propan-2-yl)silyloxyoct-6-yn-4-ol.
| Compound Name | (2R,3S,4S,5S)-2-(2-methoxyethoxymethoxy)-3,5-dimethyl-1-tri(propan-2-yl)silyloxyoct-6-yn-4-ol |
|---|---|
| PubChem CID | 101369906 |
| Molecular Formula | C23H46O5Si |
| Molecular Weight | 430.70 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | (2R,3S,4S,5S)-2-(2-methoxyethoxymethoxy)-3,5-dimethyl-1-tri(propan-2-yl)silyloxyoct-6-yn-4-ol |
| SMILES | CC#C[C@H](C)[C@H](O)[C@H](C)[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)OCOCCOC |
| InChI | InChI=1S/C23H46O5Si/c1-11-12-20(8)23(24)21(9)22(27-16-26-14-13-25-10)15-28-29(17(2)3,18(4)5)19(6)7/h17-24H,13-16H2,1-10H3/t20-,21+,22-,23-/m0/s1 |
| InChIKey | KIJHYFFKWCQQOZ-BJESRGMDSA-N |
| XLogP | 4.84 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.70 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|