C20H42O4Si2 — CID 139249822
(4S,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-6-(2-trimethylsilylethoxymethoxy)oct-1-yn-4-ol (PubChem CID 139249822) has the molecular formula C20H42O4Si2 and a molecular weight of 402.72 g/mol. Its IUPAC name is (4S,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-6-(2-trimethylsilylethoxymethoxy)oct-1-yn-4-ol.
| Compound Name | (4S,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-6-(2-trimethylsilylethoxymethoxy)oct-1-yn-4-ol |
|---|---|
| PubChem CID | 139249822 |
| Molecular Formula | C20H42O4Si2 |
| Molecular Weight | 402.72 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | (4S,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-6-(2-trimethylsilylethoxymethoxy)oct-1-yn-4-ol |
| SMILES | C#CC[C@H](O)C[C@@H](OCOCC[Si](C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O4Si2/c1-11-12-18(21)15-19(23-16-22-13-14-25(6,7)8)17(2)24-26(9,10)20(3,4)5/h1,17-19,21H,12-16H2,2-10H3/t17-,18+,19-/m1/s1 |
| InChIKey | APLSNESGCGRKJO-CEXWTWQISA-N |
| XLogP | 4.87 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.72 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|