C18H40O5Si — CID 135016309
(2R,3R,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-5-methylnonane-1,2-diol (PubChem CID 135016309) has the molecular formula C18H40O5Si and a molecular weight of 364.60 g/mol. Its IUPAC name is (2R,3R,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-5-methylnonane-1,2-diol.
| Compound Name | (2R,3R,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-5-methylnonane-1,2-diol |
|---|---|
| PubChem CID | 135016309 |
| Molecular Formula | C18H40O5Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (2R,3R,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-5-methylnonane-1,2-diol |
| SMILES | CCCC[C@H](C)[C@@H](OCOC)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO |
| InChI | InChI=1S/C18H40O5Si/c1-9-10-11-14(2)16(22-13-21-6)17(15(20)12-19)23-24(7,8)18(3,4)5/h14-17,19-20H,9-13H2,1-8H3/t14-,15+,16+,17+/m0/s1 |
| InChIKey | HOQLBPNMFOZIHD-YLFCFFPRSA-N |
| XLogP | 3.55 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|