C20H42O5Si — CID 44515761
(1R)-1-[(4R,5S)-5-[(6R)-6-[tert-butyl(dimethyl)silyl]oxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol (PubChem CID 44515761) has the molecular formula C20H42O5Si and a molecular weight of 390.64 g/mol. Its IUPAC name is (1R)-1-[(4R,5S)-5-[(6R)-6-[tert-butyl(dimethyl)silyl]oxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(4R,5S)-5-[(6R)-6-[tert-butyl(dimethyl)silyl]oxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 44515761 |
| Molecular Formula | C20H42O5Si |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | (1R)-1-[(4R,5S)-5-[(6R)-6-[tert-butyl(dimethyl)silyl]oxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol |
| SMILES | C[C@H](CCCCC[C@@H]1OC(C)(C)O[C@@H]1[C@H](O)CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O5Si/c1-15(25-26(7,8)19(2,3)4)12-10-9-11-13-17-18(16(22)14-21)24-20(5,6)23-17/h15-18,21-22H,9-14H2,1-8H3/t15-,16-,17+,18-/m1/s1 |
| InChIKey | BGEJESXRNPOZHY-ZJPYXAASSA-N |
| XLogP | 4.22 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|