C18H40O6Si2 — CID 11618400
(2R,3S,4S,5R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]oxolane-2,3,4-triol (PubChem CID 11618400) has the molecular formula C18H40O6Si2 and a molecular weight of 408.68 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]oxolane-2,3,4-triol.
| Compound Name | (2R,3S,4S,5R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 11618400 |
| Molecular Formula | C18H40O6Si2 |
| Molecular Weight | 408.68 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | (2R,3S,4S,5R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]oxolane-2,3,4-triol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@](O)(CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H40O6Si2/c1-16(2,3)25(7,8)22-11-13-14(19)15(20)18(21,24-13)12-23-26(9,10)17(4,5)6/h13-15,19-21H,11-12H2,1-10H3/t13-,14-,15+,18-/m1/s1 |
| InChIKey | SOVZNAQFSPBCIC-ZXFNITATSA-N |
| XLogP | 2.84 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.68 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|