C17H34O4 — CID 56971425
(2R)-11-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]undecan-2-ol (PubChem CID 56971425) has the molecular formula C17H34O4 and a molecular weight of 302.45 g/mol. Its IUPAC name is (2R)-11-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]undecan-2-ol.
| Compound Name | (2R)-11-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]undecan-2-ol |
|---|---|
| PubChem CID | 56971425 |
| Molecular Formula | C17H34O4 |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | (2R)-11-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]undecan-2-ol |
| SMILES | C[C@@H](O)CCCCCCCCC[C@@H]1OC(C)(C)O[C@H]1CO |
| InChI | InChI=1S/C17H34O4/c1-14(19)11-9-7-5-4-6-8-10-12-15-16(13-18)21-17(2,3)20-15/h14-16,18-19H,4-13H2,1-3H3/t14-,15+,16+/m1/s1 |
| InChIKey | KFIIGVDMXCEUSX-PMPSAXMXSA-N |
| XLogP | 3.39 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|