C19H42O4Si — CID 57326346
(4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)undecan-1-ol (PubChem CID 57326346) has the molecular formula C19H42O4Si and a molecular weight of 362.63 g/mol. Its IUPAC name is (4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)undecan-1-ol.
| Compound Name | (4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)undecan-1-ol |
|---|---|
| PubChem CID | 57326346 |
| Molecular Formula | C19H42O4Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | (4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)undecan-1-ol |
| SMILES | CCCCC[C@@H](C[C@H](CCCO)O[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C19H42O4Si/c1-8-9-10-12-17(22-16-21-5)15-18(13-11-14-20)23-24(6,7)19(2,3)4/h17-18,20H,8-16H2,1-7H3/t17-,18-/m0/s1 |
| InChIKey | VOCMJQDPRNHZCK-ROUUACIJSA-N |
| XLogP | 5.11 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|