C17H38O4Si — CID 138967167
(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)nonan-1-ol (PubChem CID 138967167) has the molecular formula C17H38O4Si and a molecular weight of 334.57 g/mol. Its IUPAC name is (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)nonan-1-ol.
| Compound Name | (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)nonan-1-ol |
|---|---|
| PubChem CID | 138967167 |
| Molecular Formula | C17H38O4Si |
| Molecular Weight | 334.57 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)nonan-1-ol |
| SMILES | CCCCC[C@H](C[C@@H](CO)OCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H38O4Si/c1-8-9-10-11-15(12-16(13-18)20-14-19-5)21-22(6,7)17(2,3)4/h15-16,18H,8-14H2,1-7H3/t15-,16+/m1/s1 |
| InChIKey | BKGGSGRPHKDURW-CVEARBPZSA-N |
| XLogP | 4.33 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|