C19H40O4Si — CID 135021412
[(4S,5R)-5-[(6S)-6-[tert-butyl(dimethyl)silyl]oxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (PubChem CID 135021412) has the molecular formula C19H40O4Si and a molecular weight of 360.61 g/mol. Its IUPAC name is [(4S,5R)-5-[(6S)-6-[tert-butyl(dimethyl)silyl]oxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4S,5R)-5-[(6S)-6-[tert-butyl(dimethyl)silyl]oxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 135021412 |
| Molecular Formula | C19H40O4Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | [(4S,5R)-5-[(6S)-6-[tert-butyl(dimethyl)silyl]oxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| SMILES | C[C@@H](CCCCC[C@H]1OC(C)(C)O[C@H]1CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O4Si/c1-15(23-24(7,8)18(2,3)4)12-10-9-11-13-16-17(14-20)22-19(5,6)21-16/h15-17,20H,9-14H2,1-8H3/t15-,16+,17-/m0/s1 |
| InChIKey | FGEFCKGRXNZLSZ-BBWFWOEESA-N |
| XLogP | 4.86 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|