C20H44O4Si — CID 135015254
(3R,6S,8S)-6-[tert-butyl(dimethyl)silyl]oxy-8-(methoxymethoxy)-3-methylundecan-1-ol (PubChem CID 135015254) has the molecular formula C20H44O4Si and a molecular weight of 376.65 g/mol. Its IUPAC name is (3R,6S,8S)-6-[tert-butyl(dimethyl)silyl]oxy-8-(methoxymethoxy)-3-methylundecan-1-ol.
| Compound Name | (3R,6S,8S)-6-[tert-butyl(dimethyl)silyl]oxy-8-(methoxymethoxy)-3-methylundecan-1-ol |
|---|---|
| PubChem CID | 135015254 |
| Molecular Formula | C20H44O4Si |
| Molecular Weight | 376.65 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | (3R,6S,8S)-6-[tert-butyl(dimethyl)silyl]oxy-8-(methoxymethoxy)-3-methylundecan-1-ol |
| SMILES | CCC[C@@H](C[C@H](CC[C@@H](C)CCO)O[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C20H44O4Si/c1-9-10-18(23-16-22-6)15-19(12-11-17(2)13-14-21)24-25(7,8)20(3,4)5/h17-19,21H,9-16H2,1-8H3/t17-,18+,19+/m1/s1 |
| InChIKey | HJXHDGFDONFHDK-QYZOEREBSA-N |
| XLogP | 5.35 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|