C26H56O4Si — CID 158214016
(3R,4R,5S,6R,9S,10S,12S)-12-[tert-butyl(dimethyl)silyl]oxy-4,10-dimethoxy-3,5,9,13-tetramethyltetradecan-6-ol (PubChem CID 158214016) has the molecular formula C26H56O4Si and a molecular weight of 460.82 g/mol. Its IUPAC name is (3R,4R,5S,6R,9S,10S,12S)-12-[tert-butyl(dimethyl)silyl]oxy-4,10-dimethoxy-3,5,9,13-tetramethyltetradecan-6-ol.
| Compound Name | (3R,4R,5S,6R,9S,10S,12S)-12-[tert-butyl(dimethyl)silyl]oxy-4,10-dimethoxy-3,5,9,13-tetramethyltetradecan-6-ol |
|---|---|
| PubChem CID | 158214016 |
| Molecular Formula | C26H56O4Si |
| Molecular Weight | 460.82 g/mol |
| Exact Mass | 460.39 |
| IUPAC Name | (3R,4R,5S,6R,9S,10S,12S)-12-[tert-butyl(dimethyl)silyl]oxy-4,10-dimethoxy-3,5,9,13-tetramethyltetradecan-6-ol |
| SMILES | CC[C@@H](C)[C@@H](OC)[C@@H](C)[C@H](O)CC[C@H](C)[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)C(C)C)OC |
| InChI | InChI=1S/C26H56O4Si/c1-14-19(4)25(29-11)21(6)22(27)16-15-20(5)24(28-10)17-23(18(2)3)30-31(12,13)26(7,8)9/h18-25,27H,14-17H2,1-13H3/t19-,20+,21+,22-,23+,24+,25-/m1/s1 |
| InChIKey | GCKNMNNQPGBPHY-YYVBKRFLSA-N |
| XLogP | 6.91 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.82 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|