C15H34O2Si — CID 134857526
(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloctan-1-ol (PubChem CID 134857526) has the molecular formula C15H34O2Si and a molecular weight of 274.52 g/mol. Its IUPAC name is (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloctan-1-ol.
| Compound Name | (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloctan-1-ol |
|---|---|
| PubChem CID | 134857526 |
| Molecular Formula | C15H34O2Si |
| Molecular Weight | 274.52 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloctan-1-ol |
| SMILES | CCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO |
| InChI | InChI=1S/C15H34O2Si/c1-8-9-10-11-14(13(2)12-16)17-18(6,7)15(3,4)5/h13-14,16H,8-12H2,1-7H3/t13-,14-/m0/s1 |
| InChIKey | YYZHKPNYZBFTCC-KBPBESRZSA-N |
| XLogP | 4.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|