C22H50O3Si2 — CID 134845348
(2R,4S,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylheptan-1-ol (PubChem CID 134845348) has the molecular formula C22H50O3Si2 and a molecular weight of 418.81 g/mol. Its IUPAC name is (2R,4S,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylheptan-1-ol.
| Compound Name | (2R,4S,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylheptan-1-ol |
|---|---|
| PubChem CID | 134845348 |
| Molecular Formula | C22H50O3Si2 |
| Molecular Weight | 418.81 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | (2R,4S,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylheptan-1-ol |
| SMILES | C[C@@H](CO)C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H50O3Si2/c1-17(15-23)14-18(2)20(25-27(12,13)22(7,8)9)19(3)16-24-26(10,11)21(4,5)6/h17-20,23H,14-16H2,1-13H3/t17-,18+,19+,20+/m1/s1 |
| InChIKey | KSLGEBRTICIUEO-FYQPLNBISA-N |
| XLogP | 6.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.81 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|