C23H50O6Si — CID 155935155
(2S,11S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-2,11-bis(methoxymethoxy)tridecan-1-ol (PubChem CID 155935155) has the molecular formula C23H50O6Si and a molecular weight of 450.73 g/mol. Its IUPAC name is (2S,11S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-2,11-bis(methoxymethoxy)tridecan-1-ol.
| Compound Name | (2S,11S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-2,11-bis(methoxymethoxy)tridecan-1-ol |
|---|---|
| PubChem CID | 155935155 |
| Molecular Formula | C23H50O6Si |
| Molecular Weight | 450.73 g/mol |
| Exact Mass | 450.34 |
| IUPAC Name | (2S,11S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-2,11-bis(methoxymethoxy)tridecan-1-ol |
| SMILES | COCO[C@H](CO)CCCCCCCC[C@H](OCOC)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H50O6Si/c1-20(29-30(7,8)23(2,3)4)22(28-19-26-6)16-14-12-10-9-11-13-15-21(17-24)27-18-25-5/h20-22,24H,9-19H2,1-8H3/t20-,21+,22+/m1/s1 |
| InChIKey | JTHMDQJSEQZNEE-FSSWDIPSSA-N |
| XLogP | 5.49 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.73 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|