C15H32O4Si — CID 25018437
3-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-ol (PubChem CID 25018437) has the molecular formula C15H32O4Si and a molecular weight of 304.50 g/mol. Its IUPAC name is 3-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-ol.
| Compound Name | 3-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 25018437 |
| Molecular Formula | C15H32O4Si |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | 3-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-ol |
| SMILES | CC1(C)O[C@@H](CCCO)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C15H32O4Si/c1-14(2,3)20(6,7)17-11-13-12(9-8-10-16)18-15(4,5)19-13/h12-13,16H,8-11H2,1-7H3/t12-,13+/m0/s1 |
| InChIKey | AISRANHKCVNRAC-QWHCGFSZSA-N |
| XLogP | 3.30 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|