C19H42O2Si — CID 101399728
(2S,4S,6R,8R)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethylnonan-1-ol (PubChem CID 101399728) has the molecular formula C19H42O2Si and a molecular weight of 330.63 g/mol. Its IUPAC name is (2S,4S,6R,8R)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethylnonan-1-ol.
| Compound Name | (2S,4S,6R,8R)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethylnonan-1-ol |
|---|---|
| PubChem CID | 101399728 |
| Molecular Formula | C19H42O2Si |
| Molecular Weight | 330.63 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | (2S,4S,6R,8R)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethylnonan-1-ol |
| SMILES | C[C@H](C[C@H](C)C[C@H](C)CO)C[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H42O2Si/c1-15(11-17(3)13-20)10-16(2)12-18(4)14-21-22(8,9)19(5,6)7/h15-18,20H,10-14H2,1-9H3/t15-,16+,17-,18+/m0/s1 |
| InChIKey | JIYRFSHMDHZVJS-XWTMOSNGSA-N |
| XLogP | 5.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.63 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|