C19H29NO5 — CID 101203011
4-[(1R,4S,5R,8S,12R,13R)-1,5-dimethyl-9-methylidene-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]morpholine (PubChem CID 101203011) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is 4-[(1R,4S,5R,8S,12R,13R)-1,5-dimethyl-9-methylidene-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]morpholine.
| Compound Name | 4-[(1R,4S,5R,8S,12R,13R)-1,5-dimethyl-9-methylidene-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]morpholine |
|---|---|
| PubChem CID | 101203011 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 4-[(1R,4S,5R,8S,12R,13R)-1,5-dimethyl-9-methylidene-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]morpholine |
| SMILES | C=C1C(N2CCOCC2)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C19H29NO5/c1-12-4-5-15-13(2)16(20-8-10-21-11-9-20)22-17-19(15)14(12)6-7-18(3,23-17)24-25-19/h12,14-17H,2,4-11H2,1,3H3/t12-,14+,15+,16?,17-,18-,19-/m1/s1 |
| InChIKey | FIZRIQWEENVBFF-RXTJFRFZSA-N |
| XLogP | 2.45 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|