C15H21NO3 — CID 101203272
methyl (E)-6-(2-buta-1,3-dien-2-yl-5-oxopyrrolidin-1-yl)hex-2-enoate (PubChem CID 101203272) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is methyl (E)-6-(2-buta-1,3-dien-2-yl-5-oxopyrrolidin-1-yl)hex-2-enoate.
| Compound Name | methyl (E)-6-(2-buta-1,3-dien-2-yl-5-oxopyrrolidin-1-yl)hex-2-enoate |
|---|---|
| PubChem CID | 101203272 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | methyl (E)-6-(2-buta-1,3-dien-2-yl-5-oxopyrrolidin-1-yl)hex-2-enoate |
| SMILES | C=CC(=C)C1CCC(=O)N1CCC/C=C/C(=O)OC |
| InChI | InChI=1S/C15H21NO3/c1-4-12(2)13-9-10-14(17)16(13)11-7-5-6-8-15(18)19-3/h4,6,8,13H,1-2,5,7,9-11H2,3H3/b8-6+ |
| InChIKey | NZCWGMOUINGZEG-SOFGYWHQSA-N |
| XLogP | 2.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|