methyl 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carboxylate

C9H11NO3 — CID 11126876

IUPACmethyl 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carboxylate
SMILESCOC(=O)C1=CCN2C(=O)CCC12
InChIInChI=1S/C9H11NO3/c1-13-9(12)6-4-5-10-7(6)2-3-8(10)11/h4,7H,2-3,5H2,1H3
InChIKeyBKVIUEIUFSVMOA-UHFFFAOYSA-N
MW181.19 g/mol
LogP0.09
Rot. Bonds1

About methyl 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carboxylate

methyl 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carboxylate (PubChem CID 11126876) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is methyl 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carboxylate.

Molecular Properties

Compound Namemethyl 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carboxylate
PubChem CID11126876
Molecular FormulaC9H11NO3
Molecular Weight181.19 g/mol
Exact Mass181.07
IUPAC Namemethyl 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carboxylate
SMILESCOC(=O)C1=CCN2C(=O)CCC12
InChIInChI=1S/C9H11NO3/c1-13-9(12)6-4-5-10-7(6)2-3-8(10)11/h4,7H,2-3,5H2,1H3
InChIKeyBKVIUEIUFSVMOA-UHFFFAOYSA-N
XLogP0.09
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.19
LogP ≤ 50.09
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carboxylate?
The IUPAC name of methyl 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carboxylate (CID 11126876) is methyl 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carboxylate.
What is the SMILES notation for methyl 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carboxylate?
The canonical SMILES for methyl 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carboxylate is COC(=O)C1=CCN2C(=O)CCC12.
What is the InChIKey of methyl 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carboxylate?
The InChIKey is BKVIUEIUFSVMOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-13-9(12)6-4-5-10-7(6)2-3-8(10)11/h4,7H,2-3,5H2,1H3.
What are the key properties of methyl 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carboxylate?
methyl 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carboxylate has a molecular weight of 181.19 g/mol, XLogP of 0.09, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carboxylate is sourced from PubChem (CID 11126876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).