C19H30O2Si — CID 101207669
[(3R)-3-[2-(3-methoxyphenyl)ethyl]-3-methylcyclohexen-1-yl]oxy-trimethylsilane (PubChem CID 101207669) has the molecular formula C19H30O2Si and a molecular weight of 318.53 g/mol. Its IUPAC name is [(3R)-3-[2-(3-methoxyphenyl)ethyl]-3-methylcyclohexen-1-yl]oxy-trimethylsilane.
| Compound Name | [(3R)-3-[2-(3-methoxyphenyl)ethyl]-3-methylcyclohexen-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 101207669 |
| Molecular Formula | C19H30O2Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | [(3R)-3-[2-(3-methoxyphenyl)ethyl]-3-methylcyclohexen-1-yl]oxy-trimethylsilane |
| SMILES | COc1cccc(CC[C@]2(C)C=C(O[Si](C)(C)C)CCC2)c1 |
| InChI | InChI=1S/C19H30O2Si/c1-19(12-7-10-18(15-19)21-22(3,4)5)13-11-16-8-6-9-17(14-16)20-2/h6,8-9,14-15H,7,10-13H2,1-5H3/t19-/m1/s1 |
| InChIKey | FAXULCMKVRUBAE-LJQANCHMSA-N |
| XLogP | 5.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|