C18H24OS2 — CID 53254724
6-[2-(3-methoxyphenyl)ethyl]-7-methyl-1,4-dithiaspiro[4.5]dec-6-ene (PubChem CID 53254724) has the molecular formula C18H24OS2 and a molecular weight of 320.52 g/mol. Its IUPAC name is 6-[2-(3-methoxyphenyl)ethyl]-7-methyl-1,4-dithiaspiro[4.5]dec-6-ene.
| Compound Name | 6-[2-(3-methoxyphenyl)ethyl]-7-methyl-1,4-dithiaspiro[4.5]dec-6-ene |
|---|---|
| PubChem CID | 53254724 |
| Molecular Formula | C18H24OS2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 6-[2-(3-methoxyphenyl)ethyl]-7-methyl-1,4-dithiaspiro[4.5]dec-6-ene |
| SMILES | COc1cccc(CCC2=C(C)CCCC23SCCS3)c1 |
| InChI | InChI=1S/C18H24OS2/c1-14-5-4-10-18(20-11-12-21-18)17(14)9-8-15-6-3-7-16(13-15)19-2/h3,6-7,13H,4-5,8-12H2,1-2H3 |
| InChIKey | KBUFBZHDKAEGCX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|