C29H26F6N4O2 — CID 10120868
N-butyl-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-phenyl-3-(pyridin-3-ylmethyl)imidazole-4-carboxamide (PubChem CID 10120868) has the molecular formula C29H26F6N4O2 and a molecular weight of 576.54 g/mol. Its IUPAC name is N-butyl-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-phenyl-3-(pyridin-3-ylmethyl)imidazole-4-carboxamide.
| Compound Name | N-butyl-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-phenyl-3-(pyridin-3-ylmethyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 10120868 |
| Molecular Formula | C29H26F6N4O2 |
| Molecular Weight | 576.54 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | N-butyl-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-phenyl-3-(pyridin-3-ylmethyl)imidazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1c(-c2ccccc2)nc(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)n1Cc1cccnc1 |
| InChI | InChI=1S/C29H26F6N4O2/c1-2-3-16-37-26(40)24-23(20-9-5-4-6-10-20)38-25(39(24)18-19-8-7-15-36-17-19)21-11-13-22(14-12-21)27(41,28(30,31)32)29(33,34)35/h4-15,17,41H,2-3,16,18H2,1H3,(H,37,40) |
| InChIKey | PRQGNIKECUVEGM-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.54 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|