C17H26O2S — CID 101209935
1-[(2S,4S)-2,4-dimethoxy-4-methylhept-6-enyl]sulfanyl-4-methylbenzene (PubChem CID 101209935) has the molecular formula C17H26O2S and a molecular weight of 294.46 g/mol. Its IUPAC name is 1-[(2S,4S)-2,4-dimethoxy-4-methylhept-6-enyl]sulfanyl-4-methylbenzene.
| Compound Name | 1-[(2S,4S)-2,4-dimethoxy-4-methylhept-6-enyl]sulfanyl-4-methylbenzene |
|---|---|
| PubChem CID | 101209935 |
| Molecular Formula | C17H26O2S |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-[(2S,4S)-2,4-dimethoxy-4-methylhept-6-enyl]sulfanyl-4-methylbenzene |
| SMILES | C=CC[C@@](C)(C[C@@H](CSc1ccc(C)cc1)OC)OC |
| InChI | InChI=1S/C17H26O2S/c1-6-11-17(3,19-5)12-15(18-4)13-20-16-9-7-14(2)8-10-16/h6-10,15H,1,11-13H2,2-5H3/t15-,17-/m0/s1 |
| InChIKey | RWEMOXVIRHBKSV-RDJZCZTQSA-N |
| XLogP | 4.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|