C34H52N2O4S — CID 101211227
[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-2-(benzylamino)pent-4-enoate (PubChem CID 101211227) has the molecular formula C34H52N2O4S and a molecular weight of 584.87 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-2-(benzylamino)pent-4-enoate.
| Compound Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-2-(benzylamino)pent-4-enoate |
|---|---|
| PubChem CID | 101211227 |
| Molecular Formula | C34H52N2O4S |
| Molecular Weight | 584.87 g/mol |
| Exact Mass | 584.36 |
| IUPAC Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-2-(benzylamino)pent-4-enoate |
| SMILES | C=CC[C@H](NCc1ccccc1)C(=O)O[C@@H]1C[C@H]2CC[C@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)C2(C)C |
| InChI | InChI=1S/C34H52N2O4S/c1-4-14-30(35-24-26-15-8-5-9-16-26)32(37)40-31-23-27-21-22-34(31,33(27,2)3)25-41(38,39)36(28-17-10-6-11-18-28)29-19-12-7-13-20-29/h4-5,8-9,15-16,27-31,35H,1,6-7,10-14,17-25H2,2-3H3/t27-,30+,31-,34-/m1/s1 |
| InChIKey | MPEVMBOABGTFQH-IHAOOPRISA-N |
| XLogP | 6.76 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.87 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|