C23H34N2O4S — CID 11112890
[(1S,2R,4R)-1-(diethylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2R)-2-phenylaziridine-2-carboxylate (PubChem CID 11112890) has the molecular formula C23H34N2O4S and a molecular weight of 434.60 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(diethylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2R)-2-phenylaziridine-2-carboxylate.
| Compound Name | [(1S,2R,4R)-1-(diethylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2R)-2-phenylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 11112890 |
| Molecular Formula | C23H34N2O4S |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | [(1S,2R,4R)-1-(diethylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2R)-2-phenylaziridine-2-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)C[C@]12CC[C@H](C[C@H]1OC(=O)[C@@]1(c3ccccc3)CN1)C2(C)C |
| InChI | InChI=1S/C23H34N2O4S/c1-5-25(6-2)30(27,28)16-22-13-12-18(21(22,3)4)14-19(22)29-20(26)23(15-24-23)17-10-8-7-9-11-17/h7-11,18-19,24H,5-6,12-16H2,1-4H3/t18-,19-,22-,23+/m1/s1 |
| InChIKey | XCHFVPCORJWBGM-NNLJWKLDSA-N |
| XLogP | 2.89 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|