C33H42N2O4S — CID 11813732
[(1S,2R,4R)-1-(diethylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S,5R,6S)-2,5-diphenyl-1-azabicyclo[4.1.0]hept-3-ene-6-carboxylate (PubChem CID 11813732) has the molecular formula C33H42N2O4S and a molecular weight of 562.78 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(diethylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S,5R,6S)-2,5-diphenyl-1-azabicyclo[4.1.0]hept-3-ene-6-carboxylate.
| Compound Name | [(1S,2R,4R)-1-(diethylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S,5R,6S)-2,5-diphenyl-1-azabicyclo[4.1.0]hept-3-ene-6-carboxylate |
|---|---|
| PubChem CID | 11813732 |
| Molecular Formula | C33H42N2O4S |
| Molecular Weight | 562.78 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | [(1S,2R,4R)-1-(diethylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S,5R,6S)-2,5-diphenyl-1-azabicyclo[4.1.0]hept-3-ene-6-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)C[C@]12CC[C@H](C[C@H]1OC(=O)[C@]13CN1[C@H](c1ccccc1)C=C[C@@H]3c1ccccc1)C2(C)C |
| InChI | InChI=1S/C33H42N2O4S/c1-5-34(6-2)40(37,38)23-32-20-19-26(31(32,3)4)21-29(32)39-30(36)33-22-35(33)28(25-15-11-8-12-16-25)18-17-27(33)24-13-9-7-10-14-24/h7-18,26-29H,5-6,19-23H2,1-4H3/t26-,27-,28+,29-,32-,33-,35?/m1/s1 |
| InChIKey | AJKFTJBVIYUCQN-NOTNIBNYSA-N |
| XLogP | 5.55 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.78 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|