C35H54N2O6S — CID 11006716
[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S,3S)-2-(ethoxycarbonylamino)-3-phenylbutanoate (PubChem CID 11006716) has the molecular formula C35H54N2O6S and a molecular weight of 630.89 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S,3S)-2-(ethoxycarbonylamino)-3-phenylbutanoate.
| Compound Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S,3S)-2-(ethoxycarbonylamino)-3-phenylbutanoate |
|---|---|
| PubChem CID | 11006716 |
| Molecular Formula | C35H54N2O6S |
| Molecular Weight | 630.89 g/mol |
| Exact Mass | 630.37 |
| IUPAC Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S,3S)-2-(ethoxycarbonylamino)-3-phenylbutanoate |
| SMILES | CCOC(=O)N[C@H](C(=O)O[C@@H]1C[C@H]2CC[C@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)C2(C)C)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C35H54N2O6S/c1-5-42-33(39)36-31(25(2)26-15-9-6-10-16-26)32(38)43-30-23-27-21-22-35(30,34(27,3)4)24-44(40,41)37(28-17-11-7-12-18-28)29-19-13-8-14-20-29/h6,9-10,15-16,25,27-31H,5,7-8,11-14,17-24H2,1-4H3,(H,36,39)/t25-,27+,30+,31-,35+/m0/s1 |
| InChIKey | TXDBHYMUNMOCAM-DIWNZZHFSA-N |
| XLogP | 6.94 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.89 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |