C32H47FN2O6S — CID 177452821
[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S,3R)-3-(2-fluorophenyl)-2-formamido-3-hydroxypropanoate (PubChem CID 177452821) has the molecular formula C32H47FN2O6S and a molecular weight of 606.80 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S,3R)-3-(2-fluorophenyl)-2-formamido-3-hydroxypropanoate.
| Compound Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S,3R)-3-(2-fluorophenyl)-2-formamido-3-hydroxypropanoate |
|---|---|
| PubChem CID | 177452821 |
| Molecular Formula | C32H47FN2O6S |
| Molecular Weight | 606.80 g/mol |
| Exact Mass | 606.31 |
| IUPAC Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S,3R)-3-(2-fluorophenyl)-2-formamido-3-hydroxypropanoate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)[C@H](OC(=O)[C@@H](NC=O)[C@H](O)c1ccccc1F)C2 |
| InChI | InChI=1S/C32H47FN2O6S/c1-31(2)22-17-18-32(31,20-42(39,40)35(23-11-5-3-6-12-23)24-13-7-4-8-14-24)27(19-22)41-30(38)28(34-21-36)29(37)25-15-9-10-16-26(25)33/h9-10,15-16,21-24,27-29,37H,3-8,11-14,17-20H2,1-2H3,(H,34,36)/t22-,27-,28+,29-,32-/m1/s1 |
| InChIKey | MSZWPCYHNQVAFE-GBRBOCEGSA-N |
| XLogP | 5.01 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.80 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|