C33H50N2O6S — CID 177421081
[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S,3R)-2-formamido-3-hydroxy-3-(2-methylphenyl)propanoate (PubChem CID 177421081) has the molecular formula C33H50N2O6S and a molecular weight of 602.84 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S,3R)-2-formamido-3-hydroxy-3-(2-methylphenyl)propanoate.
| Compound Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S,3R)-2-formamido-3-hydroxy-3-(2-methylphenyl)propanoate |
|---|---|
| PubChem CID | 177421081 |
| Molecular Formula | C33H50N2O6S |
| Molecular Weight | 602.84 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2S,3R)-2-formamido-3-hydroxy-3-(2-methylphenyl)propanoate |
| SMILES | Cc1ccccc1[C@@H](O)[C@H](NC=O)C(=O)O[C@@H]1C[C@H]2CC[C@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)C2(C)C |
| InChI | InChI=1S/C33H50N2O6S/c1-23-12-10-11-17-27(23)30(37)29(34-22-36)31(38)41-28-20-24-18-19-33(28,32(24,2)3)21-42(39,40)35(25-13-6-4-7-14-25)26-15-8-5-9-16-26/h10-12,17,22,24-26,28-30,37H,4-9,13-16,18-21H2,1-3H3,(H,34,36)/t24-,28-,29+,30-,33-/m1/s1 |
| InChIKey | FPCVQXZJQQMEAH-IYEHDNAESA-N |
| XLogP | 5.18 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.84 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|