C15H20O5 — CID 101211815
methyl (4aS,5S)-5-acetyloxy-4a-methyl-2-oxo-3,4,5,6,7,8-hexahydronaphthalene-1-carboxylate (PubChem CID 101211815) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl (4aS,5S)-5-acetyloxy-4a-methyl-2-oxo-3,4,5,6,7,8-hexahydronaphthalene-1-carboxylate.
| Compound Name | methyl (4aS,5S)-5-acetyloxy-4a-methyl-2-oxo-3,4,5,6,7,8-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 101211815 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | methyl (4aS,5S)-5-acetyloxy-4a-methyl-2-oxo-3,4,5,6,7,8-hexahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)C1=C2CCC[C@H](OC(C)=O)[C@@]2(C)CCC1=O |
| InChI | InChI=1S/C15H20O5/c1-9(16)20-12-6-4-5-10-13(14(18)19-3)11(17)7-8-15(10,12)2/h12H,4-8H2,1-3H3/t12-,15-/m0/s1 |
| InChIKey | WVAJYWPRJXBCJO-WFASDCNBSA-N |
| XLogP | 1.94 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|