C47H45N3O4P2 — CID 101213259
tert-butyl (3R,4R)-3,4-bis[(2-diphenylphosphanylbenzoyl)amino]pyrrolidine-1-carboxylate (PubChem CID 101213259) has the molecular formula C47H45N3O4P2 and a molecular weight of 777.84 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3,4-bis[(2-diphenylphosphanylbenzoyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3,4-bis[(2-diphenylphosphanylbenzoyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101213259 |
| Molecular Formula | C47H45N3O4P2 |
| Molecular Weight | 777.84 g/mol |
| Exact Mass | 777.29 |
| IUPAC Name | tert-butyl (3R,4R)-3,4-bis[(2-diphenylphosphanylbenzoyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](NC(=O)c2ccccc2P(c2ccccc2)c2ccccc2)[C@H](NC(=O)c2ccccc2P(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C47H45N3O4P2/c1-47(2,3)54-46(53)50-32-40(48-44(51)38-28-16-18-30-42(38)55(34-20-8-4-9-21-34)35-22-10-5-11-23-35)41(33-50)49-45(52)39-29-17-19-31-43(39)56(36-24-12-6-13-25-36)37-26-14-7-15-27-37/h4-31,40-41H,32-33H2,1-3H3,(H,48,51)(H,49,52)/t40-,41-/m1/s1 |
| InChIKey | HINDZRDNNYTJNV-GYOJGHLZSA-N |
| XLogP | 6.35 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.84 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|