C13H18N2O — CID 101213990
N-butyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-amine (PubChem CID 101213990) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is N-butyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-amine.
| Compound Name | N-butyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-amine |
|---|---|
| PubChem CID | 101213990 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | N-butyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-amine |
| SMILES | CCCCNC1COC(c2ccccc2)=N1 |
| InChI | InChI=1S/C13H18N2O/c1-2-3-9-14-12-10-16-13(15-12)11-7-5-4-6-8-11/h4-8,12,14H,2-3,9-10H2,1H3 |
| InChIKey | SSSHYCZCXKFTCM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|