C20H31NO2 — CID 142009009
4-(decoxymethyl)-2-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 142009009) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 4-(decoxymethyl)-2-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-(decoxymethyl)-2-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 142009009 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 4-(decoxymethyl)-2-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCCCCCCCOCC1COC(c2ccccc2)=N1 |
| InChI | InChI=1S/C20H31NO2/c1-2-3-4-5-6-7-8-12-15-22-16-19-17-23-20(21-19)18-13-10-9-11-14-18/h9-11,13-14,19H,2-8,12,15-17H2,1H3 |
| InChIKey | WLAQXBBVQWHJPM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|