C20H31NO3 — CID 69302465
(3R)-10-[[(4R)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methoxy]decan-3-ol (PubChem CID 69302465) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is (3R)-10-[[(4R)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methoxy]decan-3-ol.
| Compound Name | (3R)-10-[[(4R)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methoxy]decan-3-ol |
|---|---|
| PubChem CID | 69302465 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | (3R)-10-[[(4R)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methoxy]decan-3-ol |
| SMILES | CC[C@@H](O)CCCCCCCOC[C@@H]1COC(c2ccccc2)=N1 |
| InChI | InChI=1S/C20H31NO3/c1-2-19(22)13-9-4-3-5-10-14-23-15-18-16-24-20(21-18)17-11-7-6-8-12-17/h6-8,11-12,18-19,22H,2-5,9-10,13-16H2,1H3/t18-,19-/m1/s1 |
| InChIKey | XDBWFCFOFFHGRK-RTBURBONSA-N |
| XLogP | 3.96 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|