C13H20O3 — CID 101215453
[(3'aS,4'R,7'aS)-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,7-tetrahydro-2H-indene]-4'-yl]methanol (PubChem CID 101215453) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is [(3'aS,4'R,7'aS)-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,7-tetrahydro-2H-indene]-4'-yl]methanol.
| Compound Name | [(3'aS,4'R,7'aS)-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,7-tetrahydro-2H-indene]-4'-yl]methanol |
|---|---|
| PubChem CID | 101215453 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | [(3'aS,4'R,7'aS)-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,7-tetrahydro-2H-indene]-4'-yl]methanol |
| SMILES | C[C@]12CC=C[C@@H](CO)[C@@H]1CCC21OCCO1 |
| InChI | InChI=1S/C13H20O3/c1-12-5-2-3-10(9-14)11(12)4-6-13(12)15-7-8-16-13/h2-3,10-11,14H,4-9H2,1H3/t10-,11-,12-/m0/s1 |
| InChIKey | OFVPAIRNGUHCFM-SRVKXCTJSA-N |
| XLogP | 1.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|